C11H20 — CID 165141677
(3Z)-3,5,6-trimethylocta-1,3-diene (PubChem CID 165141677) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (3Z)-3,5,6-trimethylocta-1,3-diene.
| Compound Name | (3Z)-3,5,6-trimethylocta-1,3-diene |
|---|---|
| PubChem CID | 165141677 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (3Z)-3,5,6-trimethylocta-1,3-diene |
| SMILES | C=C/C(C)=C\C(C)C(C)CC |
| InChI | InChI=1S/C11H20/c1-6-9(3)8-11(5)10(4)7-2/h6,8,10-11H,1,7H2,2-5H3/b9-8- |
| InChIKey | YOKUCSKVCDQSKQ-HJWRWDBZSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|