C16H29N — CID 134292168
(3E)-N-butan-2-yl-N,3-dimethyl-6-methylidenenona-1,3-dien-5-amine (PubChem CID 134292168) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3E)-N-butan-2-yl-N,3-dimethyl-6-methylidenenona-1,3-dien-5-amine.
| Compound Name | (3E)-N-butan-2-yl-N,3-dimethyl-6-methylidenenona-1,3-dien-5-amine |
|---|---|
| PubChem CID | 134292168 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3E)-N-butan-2-yl-N,3-dimethyl-6-methylidenenona-1,3-dien-5-amine |
| SMILES | C=C/C(C)=C/C(C(=C)CCC)N(C)C(C)CC |
| InChI | InChI=1S/C16H29N/c1-8-11-14(5)16(12-13(4)9-2)17(7)15(6)10-3/h9,12,15-16H,2,5,8,10-11H2,1,3-4,6-7H3/b13-12+ |
| InChIKey | AAQJIIHAGRNFFV-OUKQBFOZSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|