C12H25N — CID 129237962
(E)-N-butan-2-yl-N,3-dimethylhex-2-en-2-amine (PubChem CID 129237962) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (E)-N-butan-2-yl-N,3-dimethylhex-2-en-2-amine.
| Compound Name | (E)-N-butan-2-yl-N,3-dimethylhex-2-en-2-amine |
|---|---|
| PubChem CID | 129237962 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (E)-N-butan-2-yl-N,3-dimethylhex-2-en-2-amine |
| SMILES | CCC/C(C)=C(\C)N(C)C(C)CC |
| InChI | InChI=1S/C12H25N/c1-7-9-10(3)12(5)13(6)11(4)8-2/h11H,7-9H2,1-6H3/b12-10+ |
| InChIKey | LYBHAIBEDILJRU-ZRDIBKRKSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |