C7H16N2O — CID 87182460
1-butan-2-yl-1,3-dimethylurea (PubChem CID 87182460) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-butan-2-yl-1,3-dimethylurea.
| Compound Name | 1-butan-2-yl-1,3-dimethylurea |
|---|---|
| PubChem CID | 87182460 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1-butan-2-yl-1,3-dimethylurea |
| SMILES | CCC(C)N(C)C(=O)NC |
| InChI | InChI=1S/C7H16N2O/c1-5-6(2)9(4)7(10)8-3/h6H,5H2,1-4H3,(H,8,10) |
| InChIKey | NNZMQXOJAKKPBC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |