C9H19N — CID 170734903
(E)-N,4-dimethylhept-3-en-3-amine (PubChem CID 170734903) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (E)-N,4-dimethylhept-3-en-3-amine.
| Compound Name | (E)-N,4-dimethylhept-3-en-3-amine |
|---|---|
| PubChem CID | 170734903 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (E)-N,4-dimethylhept-3-en-3-amine |
| SMILES | CCC/C(C)=C(\CC)NC |
| InChI | InChI=1S/C9H19N/c1-5-7-8(3)9(6-2)10-4/h10H,5-7H2,1-4H3/b9-8+ |
| InChIKey | WJDNNIZBBZVBKI-CMDGGOBGSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |