About butanoate;N-methylacetamide
butanoate;N-methylacetamide (PubChem CID 23457257) has the molecular formula C7H14NO3-
and a molecular weight of 160.19 g/mol. Its IUPAC name is butanoate;N-methylacetamide.
Molecular Properties
| Compound Name | butanoate;N-methylacetamide |
| PubChem CID | 23457257 |
| Molecular Formula | C7H14NO3- |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | butanoate;N-methylacetamide |
| SMILES | CCCC(=O)[O-].CNC(C)=O |
| InChI | InChI=1S/C4H8O2.C3H7NO/c1-2-3-4(5)6;1-3(5)4-2/h2-3H2,1H3,(H,5,6);1-2H3,(H,4,5)/p-1 |
| InChIKey | GWJABLSRDLFHFT-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanoate;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;N-methylacetamide?
The IUPAC name of butanoate;N-methylacetamide (CID 23457257) is butanoate;N-methylacetamide.
What is the SMILES notation for butanoate;N-methylacetamide?
The canonical SMILES for butanoate;N-methylacetamide is CCCC(=O)[O-].CNC(C)=O.
What is the InChIKey of butanoate;N-methylacetamide?
The InChIKey is GWJABLSRDLFHFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.C3H7NO/c1-2-3-4(5)6;1-3(5)4-2/h2-3H2,1H3,(H,5,6);1-2H3,(H,4,5)/p-1.
What are the key properties of butanoate;N-methylacetamide?
butanoate;N-methylacetamide has a molecular weight of 160.19 g/mol, XLogP of -0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;N-methylacetamide is sourced from PubChem (CID 23457257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).