C9H15Br — CID 143243230
(3Z)-5-bromo-3-methylhexa-1,3-diene;ethene (PubChem CID 143243230) has the molecular formula C9H15Br and a molecular weight of 203.12 g/mol. Its IUPAC name is (3Z)-5-bromo-3-methylhexa-1,3-diene;ethene.
| Compound Name | (3Z)-5-bromo-3-methylhexa-1,3-diene;ethene |
|---|---|
| PubChem CID | 143243230 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (3Z)-5-bromo-3-methylhexa-1,3-diene;ethene |
| SMILES | C=C.C=C/C(C)=C\C(C)Br |
| InChI | InChI=1S/C7H11Br.C2H4/c1-4-6(2)5-7(3)8;1-2/h4-5,7H,1H2,2-3H3;1-2H2/b6-5-; |
| InChIKey | AGASVMUPXQBESO-YSMBQZINSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|