C10H16O2 — CID 167216240
(3E)-5-hydroperoxy-3,7-dimethylocta-1,3,6-triene (PubChem CID 167216240) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E)-5-hydroperoxy-3,7-dimethylocta-1,3,6-triene.
| Compound Name | (3E)-5-hydroperoxy-3,7-dimethylocta-1,3,6-triene |
|---|---|
| PubChem CID | 167216240 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3E)-5-hydroperoxy-3,7-dimethylocta-1,3,6-triene |
| SMILES | C=C/C(C)=C/C(C=C(C)C)OO |
| InChI | InChI=1S/C10H16O2/c1-5-9(4)7-10(12-11)6-8(2)3/h5-7,10-11H,1H2,2-4H3/b9-7+ |
| InChIKey | LDDHHBDNGWUTHD-VQHVLOKHSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|