C12H19NS — CID 174253771
N-methyl-N-[(3Z)-3-methyl-7-methylidenenona-1,3,8-trien-5-yl]thiohydroxylamine (PubChem CID 174253771) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is N-methyl-N-[(3Z)-3-methyl-7-methylidenenona-1,3,8-trien-5-yl]thiohydroxylamine.
| Compound Name | N-methyl-N-[(3Z)-3-methyl-7-methylidenenona-1,3,8-trien-5-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 174253771 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-methyl-N-[(3Z)-3-methyl-7-methylidenenona-1,3,8-trien-5-yl]thiohydroxylamine |
| SMILES | C=CC(=C)CC(/C=C(/C)C=C)N(C)S |
| InChI | InChI=1S/C12H19NS/c1-6-10(3)8-12(13(5)14)9-11(4)7-2/h6-7,9,12,14H,1-3,8H2,4-5H3/b11-9- |
| InChIKey | VRTKBBSVHHNDBO-LUAWRHEFSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|