C9H17N3O — CID 145222265
(2Z,4Z)-2-amino-3-[amino(methyl)amino]-5-methylhepta-2,4,6-trien-1-ol (PubChem CID 145222265) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-3-[amino(methyl)amino]-5-methylhepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4Z)-2-amino-3-[amino(methyl)amino]-5-methylhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 145222265 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2Z,4Z)-2-amino-3-[amino(methyl)amino]-5-methylhepta-2,4,6-trien-1-ol |
| SMILES | C=C/C(C)=C\C(=C(\N)CO)N(C)N |
| InChI | InChI=1S/C9H17N3O/c1-4-7(2)5-9(12(3)11)8(10)6-13/h4-5,13H,1,6,10-11H2,2-3H3/b7-5-,9-8- |
| InChIKey | INZKSNISTNYNJZ-PJHABFGRSA-N |
| XLogP | 0.09 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|