C9H16N4 — CID 144625552
(2E)-N,N'-diamino-2-ethenyl-N,4-dimethylpenta-2,4-dienimidamide (PubChem CID 144625552) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2E)-N,N'-diamino-2-ethenyl-N,4-dimethylpenta-2,4-dienimidamide.
| Compound Name | (2E)-N,N'-diamino-2-ethenyl-N,4-dimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 144625552 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (2E)-N,N'-diamino-2-ethenyl-N,4-dimethylpenta-2,4-dienimidamide |
| SMILES | C=CC(=C\C(=C)C)/C(=N/N)N(C)N |
| InChI | InChI=1S/C9H16N4/c1-5-8(6-7(2)3)9(12-10)13(4)11/h5-6H,1-2,10-11H2,3-4H3/b8-6+,12-9- |
| InChIKey | RUYDMJGHNFJJIQ-OHSOCULHSA-N |
| XLogP | 0.75 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|