C8H13N — CID 143349848
(1Z)-N-ethenyl-N,2-dimethylbuta-1,3-dien-1-amine (PubChem CID 143349848) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (1Z)-N-ethenyl-N,2-dimethylbuta-1,3-dien-1-amine.
| Compound Name | (1Z)-N-ethenyl-N,2-dimethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143349848 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (1Z)-N-ethenyl-N,2-dimethylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C\N(C)C=C |
| InChI | InChI=1S/C8H13N/c1-5-8(3)7-9(4)6-2/h5-7H,1-2H2,3-4H3/b8-7- |
| InChIKey | GTEJGHPKTNEOHG-FPLPWBNLSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|