C14H21N — CID 155480081
(1E,3Z,5E)-N-ethenyl-N,2-dimethyl-5-prop-1-en-2-ylhepta-1,3,5-trien-1-amine (PubChem CID 155480081) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1E,3Z,5E)-N-ethenyl-N,2-dimethyl-5-prop-1-en-2-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5E)-N-ethenyl-N,2-dimethyl-5-prop-1-en-2-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 155480081 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1E,3Z,5E)-N-ethenyl-N,2-dimethyl-5-prop-1-en-2-ylhepta-1,3,5-trien-1-amine |
| SMILES | C=CN(C)/C=C(C)/C=C\C(=C/C)C(=C)C |
| InChI | InChI=1S/C14H21N/c1-7-14(12(3)4)10-9-13(5)11-15(6)8-2/h7-11H,2-3H2,1,4-6H3/b10-9-,13-11+,14-7+ |
| InChIKey | KUTLGBZXUUMRAH-WGOSVUBASA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|