C5H9IN2 — CID 156522414
(E)-N'-ethenyl-1-iodo-N'-methylethene-1,2-diamine (PubChem CID 156522414) has the molecular formula C5H9IN2 and a molecular weight of 224.04 g/mol. Its IUPAC name is (E)-N'-ethenyl-1-iodo-N'-methylethene-1,2-diamine.
| Compound Name | (E)-N'-ethenyl-1-iodo-N'-methylethene-1,2-diamine |
|---|---|
| PubChem CID | 156522414 |
| Molecular Formula | C5H9IN2 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | (E)-N'-ethenyl-1-iodo-N'-methylethene-1,2-diamine |
| SMILES | C=CN(C)/C=C(\N)I |
| InChI | InChI=1S/C5H9IN2/c1-3-8(2)4-5(6)7/h3-4H,1,7H2,2H3/b5-4- |
| InChIKey | HZOKBQOBQZFPGL-PLNGDYQASA-N |
| XLogP | 1.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|