C4H10N+ — CID 174680801
N,N-dimethylethenamine;hydron (PubChem CID 174680801) has the molecular formula C4H10N+ and a molecular weight of 72.13 g/mol. Its IUPAC name is N,N-dimethylethenamine;hydron.
| Compound Name | N,N-dimethylethenamine;hydron |
|---|---|
| PubChem CID | 174680801 |
| Molecular Formula | C4H10N+ |
| Molecular Weight | 72.13 g/mol |
| Exact Mass | 72.08 |
| IUPAC Name | N,N-dimethylethenamine;hydron |
| SMILES | C=CN(C)C.[H+] |
| InChI | InChI=1S/C4H9N/c1-4-5(2)3/h4H,1H2,2-3H3/p+1 |
| InChIKey | NINOYJQVULROET-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 72.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |