C6H12N2 — CID 139522049
(Z)-N-ethenyl-N',N'-dimethylethene-1,2-diamine (PubChem CID 139522049) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (Z)-N-ethenyl-N',N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N-ethenyl-N',N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 139522049 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (Z)-N-ethenyl-N',N'-dimethylethene-1,2-diamine |
| SMILES | C=CN/C=C\N(C)C |
| InChI | InChI=1S/C6H12N2/c1-4-7-5-6-8(2)3/h4-7H,1H2,2-3H3/b6-5- |
| InChIKey | QGWRNUSJTGHTDO-WAYWQWQTSA-N |
| XLogP | 0.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |