C11H25N — CID 143328939
(1Z)-N,N-dimethylbuta-1,3-dien-1-amine;ethane;propane (PubChem CID 143328939) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is (1Z)-N,N-dimethylbuta-1,3-dien-1-amine;ethane;propane.
| Compound Name | (1Z)-N,N-dimethylbuta-1,3-dien-1-amine;ethane;propane |
|---|---|
| PubChem CID | 143328939 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | (1Z)-N,N-dimethylbuta-1,3-dien-1-amine;ethane;propane |
| SMILES | C=C/C=C\N(C)C.CC.CCC |
| InChI | InChI=1S/C6H11N.C3H8.C2H6/c1-4-5-6-7(2)3;1-3-2;1-2/h4-6H,1H2,2-3H3;3H2,1-2H3;1-2H3/b6-5-;; |
| InChIKey | HKISNPJPYRTINO-XNOMRPDFSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|