C10H22N2 — CID 143701320
1-[(1E)-buta-1,3-dienyl]-2-ethyl-1,2-dimethylhydrazine;ethane (PubChem CID 143701320) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-2-ethyl-1,2-dimethylhydrazine;ethane.
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-2-ethyl-1,2-dimethylhydrazine;ethane |
|---|---|
| PubChem CID | 143701320 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-2-ethyl-1,2-dimethylhydrazine;ethane |
| SMILES | C=C/C=C/N(C)N(C)CC.CC |
| InChI | InChI=1S/C8H16N2.C2H6/c1-5-7-8-10(4)9(3)6-2;1-2/h5,7-8H,1,6H2,2-4H3;1-2H3/b8-7+; |
| InChIKey | AVRGQUNAZRJTEH-USRGLUTNSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|