C8H15N — CID 142943331
(1E)-N-methyl-N-propylbuta-1,3-dien-1-amine (PubChem CID 142943331) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (1E)-N-methyl-N-propylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-N-methyl-N-propylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142943331 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1E)-N-methyl-N-propylbuta-1,3-dien-1-amine |
| SMILES | C=C/C=C/N(C)CCC |
| InChI | InChI=1S/C8H15N/c1-4-6-8-9(3)7-5-2/h4,6,8H,1,5,7H2,2-3H3/b8-6+ |
| InChIKey | DEAWLUZLZRJYQZ-SOFGYWHQSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|