C8H14N2 — CID 118121074
N'-[(1E,3Z)-hexa-1,3,5-trienyl]-N'-methylmethanediamine (PubChem CID 118121074) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-[(1E,3Z)-hexa-1,3,5-trienyl]-N'-methylmethanediamine.
| Compound Name | N'-[(1E,3Z)-hexa-1,3,5-trienyl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 118121074 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-[(1E,3Z)-hexa-1,3,5-trienyl]-N'-methylmethanediamine |
| SMILES | C=C/C=C\C=C\N(C)CN |
| InChI | InChI=1S/C8H14N2/c1-3-4-5-6-7-10(2)8-9/h3-7H,1,8-9H2,2H3/b5-4-,7-6+ |
| InChIKey | ALWXADPQGBVLSO-SCFJQAPRSA-N |
| XLogP | 1.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|