About N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine
N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine (PubChem CID 89120905) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine |
| PubChem CID | 89120905 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine |
| SMILES | CC(C)/C=C\N(C)CN |
| InChI | InChI=1S/C7H16N2/c1-7(2)4-5-9(3)6-8/h4-5,7H,6,8H2,1-3H3/b5-4- |
| InChIKey | CCYQCPMQWASORL-PLNGDYQASA-N |
| XLogP | 1.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine?
The IUPAC name of N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine (CID 89120905) is N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine.
What is the SMILES notation for N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine?
The canonical SMILES for N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine is CC(C)/C=C\N(C)CN.
What is the InChIKey of N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine?
The InChIKey is CCYQCPMQWASORL-PLNGDYQASA-N. The full InChI is InChI=1S/C7H16N2/c1-7(2)4-5-9(3)6-8/h4-5,7H,6,8H2,1-3H3/b5-4-.
What are the key properties of N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine?
N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine has a molecular weight of 128.22 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(Z)-3-methylbut-1-enyl]methanediamine is sourced from PubChem (CID 89120905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).