About N'-but-3-en-2-yl-N'-methylmethanediamine
N'-but-3-en-2-yl-N'-methylmethanediamine (PubChem CID 174577366) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N'-but-3-en-2-yl-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-but-3-en-2-yl-N'-methylmethanediamine |
| PubChem CID | 174577366 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N'-but-3-en-2-yl-N'-methylmethanediamine |
| SMILES | C=CC(C)N(C)CN |
| InChI | InChI=1S/C6H14N2/c1-4-6(2)8(3)5-7/h4,6H,1,5,7H2,2-3H3 |
| InChIKey | QQWBMZCOIFQWHP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-but-3-en-2-yl-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-but-3-en-2-yl-N'-methylmethanediamine?
The IUPAC name of N'-but-3-en-2-yl-N'-methylmethanediamine (CID 174577366) is N'-but-3-en-2-yl-N'-methylmethanediamine.
What is the SMILES notation for N'-but-3-en-2-yl-N'-methylmethanediamine?
The canonical SMILES for N'-but-3-en-2-yl-N'-methylmethanediamine is C=CC(C)N(C)CN.
What is the InChIKey of N'-but-3-en-2-yl-N'-methylmethanediamine?
The InChIKey is QQWBMZCOIFQWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-4-6(2)8(3)5-7/h4,6H,1,5,7H2,2-3H3.
What are the key properties of N'-but-3-en-2-yl-N'-methylmethanediamine?
N'-but-3-en-2-yl-N'-methylmethanediamine has a molecular weight of 114.19 g/mol, XLogP of 0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-but-3-en-2-yl-N'-methylmethanediamine is sourced from PubChem (CID 174577366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).