About 2-methylpropane;prop-2-en-1-amine
2-methylpropane;prop-2-en-1-amine (PubChem CID 161130166) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is 2-methylpropane;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-methylpropane;prop-2-en-1-amine |
| PubChem CID | 161130166 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | 2-methylpropane;prop-2-en-1-amine |
| SMILES | C=CCN.CC(C)C |
| InChI | InChI=1S/C4H10.C3H7N/c1-4(2)3;1-2-3-4/h4H,1-3H3;2H,1,3-4H2 |
| InChIKey | UMBOSNPZJCXVQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;prop-2-en-1-amine?
The IUPAC name of 2-methylpropane;prop-2-en-1-amine (CID 161130166) is 2-methylpropane;prop-2-en-1-amine.
What is the SMILES notation for 2-methylpropane;prop-2-en-1-amine?
The canonical SMILES for 2-methylpropane;prop-2-en-1-amine is C=CCN.CC(C)C.
What is the InChIKey of 2-methylpropane;prop-2-en-1-amine?
The InChIKey is UMBOSNPZJCXVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H7N/c1-4(2)3;1-2-3-4/h4H,1-3H3;2H,1,3-4H2.
What are the key properties of 2-methylpropane;prop-2-en-1-amine?
2-methylpropane;prop-2-en-1-amine has a molecular weight of 115.22 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;prop-2-en-1-amine is sourced from PubChem (CID 161130166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).