About prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane)
prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 87783946) has the molecular formula C3H13NO6P2S2
and a molecular weight of 285.22 g/mol. Its IUPAC name is prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
Molecular Properties
| Compound Name | prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| PubChem CID | 87783946 |
| Molecular Formula | C3H13NO6P2S2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | C=CCN.OP(O)(O)=S.OP(O)(O)=S |
| InChI | InChI=1S/C3H7N.2H3O3PS/c1-2-3-4;2*1-4(2,3)5/h2H,1,3-4H2;2*(H3,1,2,3,5) |
| InChIKey | JJUWYVWUXFZCHN-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The IUPAC name of prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (CID 87783946) is prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
What is the SMILES notation for prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The canonical SMILES for prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is C=CCN.OP(O)(O)=S.OP(O)(O)=S.
What is the InChIKey of prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
The InChIKey is JJUWYVWUXFZCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N.2H3O3PS/c1-2-3-4;2*1-4(2,3)5/h2H,1,3-4H2;2*(H3,1,2,3,5).
What are the key properties of prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane)?
prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) has a molecular weight of 285.22 g/mol, XLogP of -1.49, 1 rotatable bonds, 7 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-en-1-amine;bis(trihydroxy(sulfanylidene)-λ5-phosphane) is sourced from PubChem (CID 87783946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).