About buta-1,3-diene;2-methylpropane
buta-1,3-diene;2-methylpropane (PubChem CID 161376198) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is buta-1,3-diene;2-methylpropane.
Molecular Properties
| Compound Name | buta-1,3-diene;2-methylpropane |
| PubChem CID | 161376198 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | buta-1,3-diene;2-methylpropane |
| SMILES | C=CC=C.CC(C)C |
| InChI | InChI=1S/C4H10.C4H6/c1-4(2)3;1-3-4-2/h4H,1-3H3;3-4H,1-2H2 |
| InChIKey | VRCOHSLPAXOLLJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;2-methylpropane?
The IUPAC name of buta-1,3-diene;2-methylpropane (CID 161376198) is buta-1,3-diene;2-methylpropane.
What is the SMILES notation for buta-1,3-diene;2-methylpropane?
The canonical SMILES for buta-1,3-diene;2-methylpropane is C=CC=C.CC(C)C.
What is the InChIKey of buta-1,3-diene;2-methylpropane?
The InChIKey is VRCOHSLPAXOLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C4H6/c1-4(2)3;1-3-4-2/h4H,1-3H3;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;2-methylpropane?
buta-1,3-diene;2-methylpropane has a molecular weight of 112.22 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;2-methylpropane is sourced from PubChem (CID 161376198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).