C6H13N — CID 13459667
N,N-dimethylbut-3-en-2-amine (PubChem CID 13459667) has the molecular formula C6H13N and a molecular weight of 99.18 g/mol. Its IUPAC name is N,N-dimethylbut-3-en-2-amine.
| Compound Name | N,N-dimethylbut-3-en-2-amine |
|---|---|
| PubChem CID | 13459667 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | N,N-dimethylbut-3-en-2-amine |
| SMILES | C=CC(C)N(C)C |
| InChI | InChI=1S/C6H13N/c1-5-6(2)7(3)4/h5-6H,1H2,2-4H3 |
| InChIKey | IWSJEVGUBTUOPS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|