C5H13NSi — CID 173042969
N,N-dimethyl-1-silylprop-2-en-1-amine (PubChem CID 173042969) has the molecular formula C5H13NSi and a molecular weight of 115.25 g/mol. Its IUPAC name is N,N-dimethyl-1-silylprop-2-en-1-amine.
| Compound Name | N,N-dimethyl-1-silylprop-2-en-1-amine |
|---|---|
| PubChem CID | 173042969 |
| Molecular Formula | C5H13NSi |
| Molecular Weight | 115.25 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | N,N-dimethyl-1-silylprop-2-en-1-amine |
| SMILES | C=CC([SiH3])N(C)C |
| InChI | InChI=1S/C5H13NSi/c1-4-5(7)6(2)3/h4-5H,1H2,2-3,7H3 |
| InChIKey | SIZSJRLMKYLWAR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|