C14H30N2 — CID 138495118
N'-[(Z)-5,8-dimethyldec-3-en-2-yl]-N'-methylmethanediamine (PubChem CID 138495118) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-[(Z)-5,8-dimethyldec-3-en-2-yl]-N'-methylmethanediamine.
| Compound Name | N'-[(Z)-5,8-dimethyldec-3-en-2-yl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 138495118 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-[(Z)-5,8-dimethyldec-3-en-2-yl]-N'-methylmethanediamine |
| SMILES | CCC(C)CCC(C)/C=C\C(C)N(C)CN |
| InChI | InChI=1S/C14H30N2/c1-6-12(2)7-8-13(3)9-10-14(4)16(5)11-15/h9-10,12-14H,6-8,11,15H2,1-5H3/b10-9- |
| InChIKey | FNVNGJRZQXONCT-KTKRTIGZSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|