C11H20O — CID 91082356
4,7-dimethylnon-2-enal (PubChem CID 91082356) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 4,7-dimethylnon-2-enal.
| Compound Name | 4,7-dimethylnon-2-enal |
|---|---|
| PubChem CID | 91082356 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4,7-dimethylnon-2-enal |
| SMILES | CCC(C)CCC(C)C=CC=O |
| InChI | InChI=1S/C11H20O/c1-4-10(2)7-8-11(3)6-5-9-12/h5-6,9-11H,4,7-8H2,1-3H3 |
| InChIKey | CNTJVVZEWQQTAM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|