About 4,7-dimethylnon-2-enal
4,7-dimethylnon-2-enal (PubChem CID 91082356) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4,7-dimethylnon-2-enal.
Molecular Properties
| Compound Name | 4,7-dimethylnon-2-enal |
| PubChem CID | 91082356 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4,7-dimethylnon-2-enal |
| SMILES | CCC(C)CCC(C)C=CC=O |
| InChI | InChI=1S/C11H20O/c1-4-10(2)7-8-11(3)6-5-9-12/h5-6,9-11H,4,7-8H2,1-3H3 |
| InChIKey | CNTJVVZEWQQTAM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethylnon-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethylnon-2-enal?
The IUPAC name of 4,7-dimethylnon-2-enal (CID 91082356) is 4,7-dimethylnon-2-enal.
What is the SMILES notation for 4,7-dimethylnon-2-enal?
The canonical SMILES for 4,7-dimethylnon-2-enal is CCC(C)CCC(C)C=CC=O.
What is the InChIKey of 4,7-dimethylnon-2-enal?
The InChIKey is CNTJVVZEWQQTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-4-10(2)7-8-11(3)6-5-9-12/h5-6,9-11H,4,7-8H2,1-3H3.
What are the key properties of 4,7-dimethylnon-2-enal?
4,7-dimethylnon-2-enal has a molecular weight of 168.28 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethylnon-2-enal is sourced from PubChem (CID 91082356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).