About (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane
(Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane (PubChem CID 142053710) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane.
Molecular Properties
| Compound Name | (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane |
| PubChem CID | 142053710 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane |
| SMILES | C/C=C\N(C)/C=C\C(C)C.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-5-7-10(4)8-6-9(2)3;1-2/h5-9H,1-4H3;1-2H3/b7-5-,8-6-; |
| InChIKey | XLHFKPSEFIZCOD-OVDGFJEXSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane?
The IUPAC name of (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane (CID 142053710) is (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane.
What is the SMILES notation for (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane?
The canonical SMILES for (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane is C/C=C\N(C)/C=C\C(C)C.CC.
What is the InChIKey of (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane?
The InChIKey is XLHFKPSEFIZCOD-OVDGFJEXSA-N. The full InChI is InChI=1S/C9H17N.C2H6/c1-5-7-10(4)8-6-9(2)3;1-2/h5-9H,1-4H3;1-2H3/b7-5-,8-6-;.
What are the key properties of (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane?
(Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane has a molecular weight of 169.31 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,3-dimethyl-N-[(Z)-prop-1-enyl]but-1-en-1-amine;ethane is sourced from PubChem (CID 142053710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).