C9H18N2O2 — CID 155460362
1-(1-methoxyethyl)-1,3-dimethyl-3-[(E)-prop-1-enyl]urea (PubChem CID 155460362) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-(1-methoxyethyl)-1,3-dimethyl-3-[(E)-prop-1-enyl]urea.
| Compound Name | 1-(1-methoxyethyl)-1,3-dimethyl-3-[(E)-prop-1-enyl]urea |
|---|---|
| PubChem CID | 155460362 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-(1-methoxyethyl)-1,3-dimethyl-3-[(E)-prop-1-enyl]urea |
| SMILES | C/C=C/N(C)C(=O)N(C)C(C)OC |
| InChI | InChI=1S/C9H18N2O2/c1-6-7-10(3)9(12)11(4)8(2)13-5/h6-8H,1-5H3/b7-6+ |
| InChIKey | MBDBZYLBEUWTJA-VOTSOKGWSA-N |
| XLogP | 1.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|