C9H19N3O — CID 166874136
(Z)-1-N-[(Z)-ethylideneamino]-2-N-(1-methoxyethyl)-2-N-methylprop-1-ene-1,2-diamine (PubChem CID 166874136) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (Z)-1-N-[(Z)-ethylideneamino]-2-N-(1-methoxyethyl)-2-N-methylprop-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-[(Z)-ethylideneamino]-2-N-(1-methoxyethyl)-2-N-methylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 166874136 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (Z)-1-N-[(Z)-ethylideneamino]-2-N-(1-methoxyethyl)-2-N-methylprop-1-ene-1,2-diamine |
| SMILES | C/C=N\N/C=C(/C)N(C)C(C)OC |
| InChI | InChI=1S/C9H19N3O/c1-6-10-11-7-8(2)12(4)9(3)13-5/h6-7,9,11H,1-5H3/b8-7-,10-6- |
| InChIKey | LYXITWZFNNEJTK-OYIUBJQVSA-N |
| XLogP | 1.37 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|