C6H12N2O — CID 44554794
1,3-dimethyl-1-[(E)-prop-1-enyl]urea (PubChem CID 44554794) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,3-dimethyl-1-[(E)-prop-1-enyl]urea.
| Compound Name | 1,3-dimethyl-1-[(E)-prop-1-enyl]urea |
|---|---|
| PubChem CID | 44554794 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1,3-dimethyl-1-[(E)-prop-1-enyl]urea |
| SMILES | C/C=C/N(C)C(=O)NC |
| InChI | InChI=1S/C6H12N2O/c1-4-5-8(3)6(9)7-2/h4-5H,1-3H3,(H,7,9)/b5-4+ |
| InChIKey | UWUPDVQRBXEAJZ-SNAWJCMRSA-N |
| XLogP | 0.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |