C4H12N2O6P2+2 — CID 87619388
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,1,3-trimethylurea (PubChem CID 87619388) has the molecular formula C4H12N2O6P2+2 and a molecular weight of 246.10 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,1,3-trimethylurea.
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,1,3-trimethylurea |
|---|---|
| PubChem CID | 87619388 |
| Molecular Formula | C4H12N2O6P2+2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;1,1,3-trimethylurea |
| SMILES | CNC(=O)N(C)C.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C4H10N2O.O5P2/c1-5-4(7)6(2)3;1-6(2)5-7(3)4/h1-3H3,(H,5,7);/p+2 |
| InChIKey | JHNJDXIYNPMAQO-UHFFFAOYSA-P |
| XLogP | 0.19 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|