About hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine (PubChem CID 88757783) has the molecular formula C3H11NO5P2+2
and a molecular weight of 203.07 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine.
Molecular Properties
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine |
| PubChem CID | 88757783 |
| Molecular Formula | C3H11NO5P2+2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine |
| SMILES | CCNC.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C3H9N.O5P2/c1-3-4-2;1-6(2)5-7(3)4/h4H,3H2,1-2H3;/p+2 |
| InChIKey | KZOGSCIWHNYJSH-UHFFFAOYSA-P |
| XLogP | 0.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine?
The IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine (CID 88757783) is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine.
What is the SMILES notation for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine?
The canonical SMILES for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine is CCNC.O=[P+](O)O[P+](=O)O.
What is the InChIKey of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine?
The InChIKey is KZOGSCIWHNYJSH-UHFFFAOYSA-P. The full InChI is InChI=1S/C3H9N.O5P2/c1-3-4-2;1-6(2)5-7(3)4/h4H,3H2,1-2H3;/p+2.
What are the key properties of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine?
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine has a molecular weight of 203.07 g/mol, XLogP of 0.53, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;N-methylethanamine is sourced from PubChem (CID 88757783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).