C4H11NO7P2+2 — CID 88757252
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;3-(methylamino)propanoic acid (PubChem CID 88757252) has the molecular formula C4H11NO7P2+2 and a molecular weight of 247.08 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;3-(methylamino)propanoic acid.
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;3-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 88757252 |
| Molecular Formula | C4H11NO7P2+2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;3-(methylamino)propanoic acid |
| SMILES | CNCCC(=O)O.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C4H9NO2.O5P2/c1-5-3-2-4(6)7;1-6(2)5-7(3)4/h5H,2-3H2,1H3,(H,6,7);/p+2 |
| InChIKey | AMBCGWWPNWUCNP-UHFFFAOYSA-P |
| XLogP | -0.02 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|