About hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium (PubChem CID 175840101) has the molecular formula H2O5P2V+2
and a molecular weight of 194.90 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium.
Molecular Properties
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium |
| PubChem CID | 175840101 |
| Molecular Formula | H2O5P2V+2 |
| Molecular Weight | 194.90 g/mol |
| Exact Mass | 194.88 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium |
| SMILES | O=[P+](O)O[P+](=O)O.[V] |
| InChI | InChI=1S/O5P2.V/c1-6(2)5-7(3)4;/p+2 |
| InChIKey | OORYPLJMMLANED-UHFFFAOYSA-P |
| XLogP | 0.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.90 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium?
The IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium (CID 175840101) is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium.
What is the SMILES notation for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium?
The canonical SMILES for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium is O=[P+](O)O[P+](=O)O.[V].
What is the InChIKey of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium?
The InChIKey is OORYPLJMMLANED-UHFFFAOYSA-P. The full InChI is InChI=1S/O5P2.V/c1-6(2)5-7(3)4;/p+2.
What are the key properties of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium?
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium has a molecular weight of 194.90 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;vanadium is sourced from PubChem (CID 175840101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).