About hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc (PubChem CID 174802385) has the molecular formula H5O9P3Zn2+2
and a molecular weight of 372.73 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc.
Molecular Properties
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc |
| PubChem CID | 174802385 |
| Molecular Formula | H5O9P3Zn2+2 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 369.77 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc |
| SMILES | O=P(O)(O)O.O=[P+](O)O[P+](=O)O.[Zn].[Zn] |
| InChI | InChI=1S/O5P2.H3O4P.2Zn/c1-6(2)5-7(3)4;1-5(2,3)4;;/h;(H3,1,2,3,4);;/p+2 |
| InChIKey | NMHILPQVZMLIGH-UHFFFAOYSA-P |
| XLogP | -0.63 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc?
The IUPAC name of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc (CID 174802385) is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc.
What is the SMILES notation for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc?
The canonical SMILES for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc is O=P(O)(O)O.O=[P+](O)O[P+](=O)O.[Zn].[Zn].
What is the InChIKey of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc?
The InChIKey is NMHILPQVZMLIGH-UHFFFAOYSA-P. The full InChI is InChI=1S/O5P2.H3O4P.2Zn/c1-6(2)5-7(3)4;1-5(2,3)4;;/h;(H3,1,2,3,4);;/p+2.
What are the key properties of hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc?
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc has a molecular weight of 372.73 g/mol, XLogP of -0.63, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;phosphoric acid;zinc is sourced from PubChem (CID 174802385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).