About dihydroxy(oxo)phosphanium;phosphoric acid;zirconium
dihydroxy(oxo)phosphanium;phosphoric acid;zirconium (PubChem CID 173299921) has the molecular formula H5O7P2Zr+
and a molecular weight of 270.21 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;phosphoric acid;zirconium.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;phosphoric acid;zirconium |
| PubChem CID | 173299921 |
| Molecular Formula | H5O7P2Zr+ |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 268.86 |
| IUPAC Name | dihydroxy(oxo)phosphanium;phosphoric acid;zirconium |
| SMILES | O=P(O)(O)O.O=[P+](O)O.[Zr] |
| InChI | InChI=1S/H3O4P.HO3P.Zr/c1-5(2,3)4;1-4(2)3;/h(H3,1,2,3,4);(H-,1,2,3);/p+1 |
| InChIKey | RWGDRMKFNDKXPT-UHFFFAOYSA-O |
| XLogP | -1.30 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;phosphoric acid;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;phosphoric acid;zirconium?
The IUPAC name of dihydroxy(oxo)phosphanium;phosphoric acid;zirconium (CID 173299921) is dihydroxy(oxo)phosphanium;phosphoric acid;zirconium.
What is the SMILES notation for dihydroxy(oxo)phosphanium;phosphoric acid;zirconium?
The canonical SMILES for dihydroxy(oxo)phosphanium;phosphoric acid;zirconium is O=P(O)(O)O.O=[P+](O)O.[Zr].
What is the InChIKey of dihydroxy(oxo)phosphanium;phosphoric acid;zirconium?
The InChIKey is RWGDRMKFNDKXPT-UHFFFAOYSA-O. The full InChI is InChI=1S/H3O4P.HO3P.Zr/c1-5(2,3)4;1-4(2)3;/h(H3,1,2,3,4);(H-,1,2,3);/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;phosphoric acid;zirconium?
dihydroxy(oxo)phosphanium;phosphoric acid;zirconium has a molecular weight of 270.21 g/mol, XLogP of -1.30, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;phosphoric acid;zirconium is sourced from PubChem (CID 173299921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).