About azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese
azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese (PubChem CID 174488073) has the molecular formula H5MnNO5P2+2
and a molecular weight of 215.93 g/mol. Its IUPAC name is azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese.
Molecular Properties
| Compound Name | azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese |
| PubChem CID | 174488073 |
| Molecular Formula | H5MnNO5P2+2 |
| Molecular Weight | 215.93 g/mol |
| Exact Mass | 215.90 |
| IUPAC Name | azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese |
| SMILES | N.O=[P+](O)O[P+](=O)O.[Mn] |
| InChI | InChI=1S/Mn.H3N.O5P2/c;;1-6(2)5-7(3)4/h;1H3;/p+2 |
| InChIKey | BEAUKLYVSQZSJC-UHFFFAOYSA-P |
| XLogP | 0.46 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.93 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese?
The IUPAC name of azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese (CID 174488073) is azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese.
What is the SMILES notation for azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese?
The canonical SMILES for azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese is N.O=[P+](O)O[P+](=O)O.[Mn].
What is the InChIKey of azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese?
The InChIKey is BEAUKLYVSQZSJC-UHFFFAOYSA-P. The full InChI is InChI=1S/Mn.H3N.O5P2/c;;1-6(2)5-7(3)4/h;1H3;/p+2.
What are the key properties of azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese?
azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese has a molecular weight of 215.93 g/mol, XLogP of 0.46, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;manganese is sourced from PubChem (CID 174488073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).