C6H12N4O2 — CID 131233680
1-[[(E)-2-aminoethenyl]carbamoyl]-1,3-dimethylurea (PubChem CID 131233680) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is 1-[[(E)-2-aminoethenyl]carbamoyl]-1,3-dimethylurea.
| Compound Name | 1-[[(E)-2-aminoethenyl]carbamoyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 131233680 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-[[(E)-2-aminoethenyl]carbamoyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C(=O)N/C=C/N |
| InChI | InChI=1S/C6H12N4O2/c1-8-5(11)10(2)6(12)9-4-3-7/h3-4H,7H2,1-2H3,(H,8,11)(H,9,12)/b4-3+ |
| InChIKey | DJXXZORGUUSOAO-ONEGZZNKSA-N |
| XLogP | -0.60 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |