C5H7N4O6- — CID 177455499
1-[methyl(methylcarbamoyl)amino]-2,2-dinitroethenolate (PubChem CID 177455499) has the molecular formula C5H7N4O6- and a molecular weight of 219.13 g/mol. Its IUPAC name is 1-[methyl(methylcarbamoyl)amino]-2,2-dinitroethenolate.
| Compound Name | 1-[methyl(methylcarbamoyl)amino]-2,2-dinitroethenolate |
|---|---|
| PubChem CID | 177455499 |
| Molecular Formula | C5H7N4O6- |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 1-[methyl(methylcarbamoyl)amino]-2,2-dinitroethenolate |
| SMILES | CNC(=O)N(C)C([O-])=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N4O6/c1-6-5(11)7(2)4(10)3(8(12)13)9(14)15/h10H,1-2H3,(H,6,11)/p-1 |
| InChIKey | FIQZMAQOJYXRHR-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|