C3H8N2OSe — CID 173304462
1,3-dimethyl-1-selanylurea (PubChem CID 173304462) has the molecular formula C3H8N2OSe and a molecular weight of 167.07 g/mol. Its IUPAC name is 1,3-dimethyl-1-selanylurea.
| Compound Name | 1,3-dimethyl-1-selanylurea |
|---|---|
| PubChem CID | 173304462 |
| Molecular Formula | C3H8N2OSe |
| Molecular Weight | 167.07 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | 1,3-dimethyl-1-selanylurea |
| SMILES | CNC(=O)N(C)[SeH] |
| InChI | InChI=1S/C3H8N2OSe/c1-4-3(6)5(2)7/h7H,1-2H3,(H,4,6) |
| InChIKey | IMEISRDATFJSDI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.07 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|