About 1,3-dimethyl-1-selanylurea
1,3-dimethyl-1-selanylurea (PubChem CID 173304462) has the molecular formula C3H8N2OSe
and a molecular weight of 167.07 g/mol. Its IUPAC name is 1,3-dimethyl-1-selanylurea.
Molecular Properties
| Compound Name | 1,3-dimethyl-1-selanylurea |
| PubChem CID | 173304462 |
| Molecular Formula | C3H8N2OSe |
| Molecular Weight | 167.07 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | 1,3-dimethyl-1-selanylurea |
| SMILES | CNC(=O)N(C)[SeH] |
| InChI | InChI=1S/C3H8N2OSe/c1-4-3(6)5(2)7/h7H,1-2H3,(H,4,6) |
| InChIKey | IMEISRDATFJSDI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.07 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1-selanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1-selanylurea?
The IUPAC name of 1,3-dimethyl-1-selanylurea (CID 173304462) is 1,3-dimethyl-1-selanylurea.
What is the SMILES notation for 1,3-dimethyl-1-selanylurea?
The canonical SMILES for 1,3-dimethyl-1-selanylurea is CNC(=O)N(C)[SeH].
What is the InChIKey of 1,3-dimethyl-1-selanylurea?
The InChIKey is IMEISRDATFJSDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2OSe/c1-4-3(6)5(2)7/h7H,1-2H3,(H,4,6).
What are the key properties of 1,3-dimethyl-1-selanylurea?
1,3-dimethyl-1-selanylurea has a molecular weight of 167.07 g/mol, XLogP of -0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1-selanylurea is sourced from PubChem (CID 173304462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).