C7H10N2OS — CID 115168951
1,3-dimethyl-1-thiophen-2-ylurea (PubChem CID 115168951) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 1,3-dimethyl-1-thiophen-2-ylurea.
| Compound Name | 1,3-dimethyl-1-thiophen-2-ylurea |
|---|---|
| PubChem CID | 115168951 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1,3-dimethyl-1-thiophen-2-ylurea |
| SMILES | CNC(=O)N(C)c1cccs1 |
| InChI | InChI=1S/C7H10N2OS/c1-8-7(10)9(2)6-4-3-5-11-6/h3-5H,1-2H3,(H,8,10) |
| InChIKey | WSPDDIWEJGZJGV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |