C13H21N3OS — CID 115189078
N,2-dimethyl-3-piperazin-1-yl-N-thiophen-2-ylpropanamide (PubChem CID 115189078) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N,2-dimethyl-3-piperazin-1-yl-N-thiophen-2-ylpropanamide.
| Compound Name | N,2-dimethyl-3-piperazin-1-yl-N-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 115189078 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N,2-dimethyl-3-piperazin-1-yl-N-thiophen-2-ylpropanamide |
| SMILES | CC(CN1CCNCC1)C(=O)N(C)c1cccs1 |
| InChI | InChI=1S/C13H21N3OS/c1-11(10-16-7-5-14-6-8-16)13(17)15(2)12-4-3-9-18-12/h3-4,9,11,14H,5-8,10H2,1-2H3 |
| InChIKey | IORHVJYMDQDSRN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |