C17H12N2OS4 — CID 19774771
1,1,3,3-tetrathiophen-2-ylurea (PubChem CID 19774771) has the molecular formula C17H12N2OS4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1,1,3,3-tetrathiophen-2-ylurea.
| Compound Name | 1,1,3,3-tetrathiophen-2-ylurea |
|---|---|
| PubChem CID | 19774771 |
| Molecular Formula | C17H12N2OS4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 1,1,3,3-tetrathiophen-2-ylurea |
| SMILES | O=C(N(c1cccs1)c1cccs1)N(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H12N2OS4/c20-17(18(13-5-1-9-21-13)14-6-2-10-22-14)19(15-7-3-11-23-15)16-8-4-12-24-16/h1-12H |
| InChIKey | GTYSCTMXZBWZQG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |