3-[methyl(thiophen-2-yl)amino]benzoic acid

C12H11NO2S — CID 117043052

IUPAC3-[methyl(thiophen-2-yl)amino]benzoic acid
SMILESCN(c1cccc(C(=O)O)c1)c1cccs1
InChIInChI=1S/C12H11NO2S/c1-13(11-6-3-7-16-11)10-5-2-4-9(8-10)12(14)15/h2-8H,1H3,(H,14,15)
InChIKeyMCWAQGNUGOZLLG-UHFFFAOYSA-N
MW233.29 g/mol
LogP3.21
Rot. Bonds3

About 3-[methyl(thiophen-2-yl)amino]benzoic acid

3-[methyl(thiophen-2-yl)amino]benzoic acid (PubChem CID 117043052) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 3-[methyl(thiophen-2-yl)amino]benzoic acid.

Molecular Properties

Compound Name3-[methyl(thiophen-2-yl)amino]benzoic acid
PubChem CID117043052
Molecular FormulaC12H11NO2S
Molecular Weight233.29 g/mol
Exact Mass233.05
IUPAC Name3-[methyl(thiophen-2-yl)amino]benzoic acid
SMILESCN(c1cccc(C(=O)O)c1)c1cccs1
InChIInChI=1S/C12H11NO2S/c1-13(11-6-3-7-16-11)10-5-2-4-9(8-10)12(14)15/h2-8H,1H3,(H,14,15)
InChIKeyMCWAQGNUGOZLLG-UHFFFAOYSA-N
XLogP3.21
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.29
LogP ≤ 53.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[methyl(thiophen-2-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(N,4-dimethylanilino)benzoic acid
CID 102822798
3-[methyl(pyrimidin-2-yl)amino]benzoic acid
CID 82512926
3-(4-chloro-N-methylanilino)benzoic acid
CID 117029301
3-(N,3,4-trimethylanilino)benzoic acid
CID 117029291
3-[2-[3-[sulfino(thiophen-2-yl)amino]phenyl]ethyl]benzoic acid
CID 68692813
3-(2-chloro-N-methylanilino)benzoic acid
CID 117029299
3-[methyl(1H-pyrrol-3-yl)amino]benzoic acid
CID 117043065
4-(3-acetyl-N-methylanilino)benzoic acid
CID 117029329
benzoic acid;N-methyl-N-phenylaniline
CID 158055475
3-(dimethylamino)benzoic acid;1H-pyrrole
CID 174771753
3-(N-[4-[N-(3-carboxyphenyl)-4-[N-(3-carboxyphenyl)-4-[N-(3-carboxyphenyl)-4-(N-(3-carboxyphenyl)anilino)anilino]anilino]anilino]phenyl]anilino)benzoic acid
CID 101061815
3-(1-thiophen-2-ylethoxy)benzoic acid
CID 82037598

Frequently Asked Questions

What is the IUPAC name of 3-[methyl(thiophen-2-yl)amino]benzoic acid?
The IUPAC name of 3-[methyl(thiophen-2-yl)amino]benzoic acid (CID 117043052) is 3-[methyl(thiophen-2-yl)amino]benzoic acid.
What is the SMILES notation for 3-[methyl(thiophen-2-yl)amino]benzoic acid?
The canonical SMILES for 3-[methyl(thiophen-2-yl)amino]benzoic acid is CN(c1cccc(C(=O)O)c1)c1cccs1.
What is the InChIKey of 3-[methyl(thiophen-2-yl)amino]benzoic acid?
The InChIKey is MCWAQGNUGOZLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-13(11-6-3-7-16-11)10-5-2-4-9(8-10)12(14)15/h2-8H,1H3,(H,14,15).
What are the key properties of 3-[methyl(thiophen-2-yl)amino]benzoic acid?
3-[methyl(thiophen-2-yl)amino]benzoic acid has a molecular weight of 233.29 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(thiophen-2-yl)amino]benzoic acid is sourced from PubChem (CID 117043052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).