C19H17NO4S2 — CID 68692813
3-[2-[3-[sulfino(thiophen-2-yl)amino]phenyl]ethyl]benzoic acid (PubChem CID 68692813) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[2-[3-[sulfino(thiophen-2-yl)amino]phenyl]ethyl]benzoic acid.
| Compound Name | 3-[2-[3-[sulfino(thiophen-2-yl)amino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68692813 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-[2-[3-[sulfino(thiophen-2-yl)amino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCc2cccc(N(c3cccs3)S(=O)O)c2)c1 |
| InChI | InChI=1S/C19H17NO4S2/c21-19(22)16-6-1-4-14(12-16)9-10-15-5-2-7-17(13-15)20(26(23)24)18-8-3-11-25-18/h1-8,11-13H,9-10H2,(H,21,22)(H,23,24) |
| InChIKey | PURXRUZWIGODSZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|