C25H20NO4S- — CID 68690941
1-[4-[2-(3-carboxyphenyl)ethyl]-N-sulfinatoanilino]naphthalene (PubChem CID 68690941) has the molecular formula C25H20NO4S- and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[4-[2-(3-carboxyphenyl)ethyl]-N-sulfinatoanilino]naphthalene.
| Compound Name | 1-[4-[2-(3-carboxyphenyl)ethyl]-N-sulfinatoanilino]naphthalene |
|---|---|
| PubChem CID | 68690941 |
| Molecular Formula | C25H20NO4S- |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-[4-[2-(3-carboxyphenyl)ethyl]-N-sulfinatoanilino]naphthalene |
| SMILES | O=C(O)c1cccc(CCc2ccc(N(c3cccc4ccccc34)S(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H21NO4S/c27-25(28)21-8-3-5-19(17-21)12-11-18-13-15-22(16-14-18)26(31(29)30)24-10-4-7-20-6-1-2-9-23(20)24/h1-10,13-17H,11-12H2,(H,27,28)(H,29,30)/p-1 |
| InChIKey | YJBZIZSYMRNPFI-UHFFFAOYSA-M |
| XLogP | 5.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|