About methylcarbamoyl thiophene-2-carboxylate
methylcarbamoyl thiophene-2-carboxylate (PubChem CID 143396062) has the molecular formula C7H7NO3S
and a molecular weight of 185.20 g/mol. Its IUPAC name is methylcarbamoyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methylcarbamoyl thiophene-2-carboxylate |
| PubChem CID | 143396062 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | methylcarbamoyl thiophene-2-carboxylate |
| SMILES | CNC(=O)OC(=O)c1cccs1 |
| InChI | InChI=1S/C7H7NO3S/c1-8-7(10)11-6(9)5-3-2-4-12-5/h2-4H,1H3,(H,8,10) |
| InChIKey | XKRBPEIMCOMTIJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamoyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamoyl thiophene-2-carboxylate?
The IUPAC name of methylcarbamoyl thiophene-2-carboxylate (CID 143396062) is methylcarbamoyl thiophene-2-carboxylate.
What is the SMILES notation for methylcarbamoyl thiophene-2-carboxylate?
The canonical SMILES for methylcarbamoyl thiophene-2-carboxylate is CNC(=O)OC(=O)c1cccs1.
What is the InChIKey of methylcarbamoyl thiophene-2-carboxylate?
The InChIKey is XKRBPEIMCOMTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S/c1-8-7(10)11-6(9)5-3-2-4-12-5/h2-4H,1H3,(H,8,10).
What are the key properties of methylcarbamoyl thiophene-2-carboxylate?
methylcarbamoyl thiophene-2-carboxylate has a molecular weight of 185.20 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamoyl thiophene-2-carboxylate is sourced from PubChem (CID 143396062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).